1,5-DMethyl-1H-prazole-4-MethanaMine hydrochloride
1,5-dimethyl-1H-Pyrazole-4-Methanamine, hydrochloride
CAS: 449811-81-8
Molecular Formula: C6H12ClN3
1,5-DMethyl-1H-prazole-4-MethanaMine hydrochloride - Names and Identifiers
| Name | 1,5-dimethyl-1H-Pyrazole-4-Methanamine, hydrochloride |
| Synonyms | 1,5-DMethyl-1H-prazole-4-MethanaMine hydrochloride 1,5-Dmethyl-1H-prazole-4-methanamineonohydrochloride 1,5-dimethyl-1H-Pyrazole-4-Methanamine, hydrochloride |
| CAS | 449811-81-8 |
| InChI | InChI=1S/C6H11N3.ClH/c1-5-6(3-7)4-8-9(5)2;/h4H,3,7H2,1-2H3;1H |
1,5-DMethyl-1H-prazole-4-MethanaMine hydrochloride - Physico-chemical Properties
| Molecular Formula | C6H12ClN3 |
| Molar Mass | 161.63 |
1,5-DMethyl-1H-prazole-4-MethanaMine hydrochloride - Introduction
1. hydrochloride is a chemical compound whose chemical formula is C6H11N3 · HCl. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
-Appearance: White or light yellow crystalline powder
-Melting point: 170-180°C
-Solubility: Soluble in water, methanol and ethanol, slightly soluble in ether
Use:
- 1, hydrochloride is often used as an intermediate and catalyst in organic synthesis
-It is usually used to synthesize drugs and biologically active compounds
-It can be used as a ligand in coordination chemistry and metal organic chemistry research
Preparation Method:
1, the preparation of hydrochloride usually involves the following steps:
1. Under appropriate reaction conditions, methylamine and 1,5-dimethyl-1H-pyrazole are reacted through an alkylation reaction to form (1,5-dimethyl-1H-pyrazol-4-yl) methylamine.
2. React (1,5-dimethyl-1H-pyrazol-4-yl) methylamine with hydrochloric acid to obtain 1, hydrochloride.
Safety Information:
- 1, hydrochloride it is relatively safe under normal conditions, it still needs safe operation.
-Wear appropriate protective gloves and glasses when using to prevent contact and inhalation.
-Use under closed ventilation conditions to avoid breathing aerosols or vapors.
-Avoid contact with oxidants and strong acids.
-During storage, it should be kept in a dry, cool, well-ventilated place, away from fire and flammable materials.
Nature:
-Appearance: White or light yellow crystalline powder
-Melting point: 170-180°C
-Solubility: Soluble in water, methanol and ethanol, slightly soluble in ether
Use:
- 1, hydrochloride is often used as an intermediate and catalyst in organic synthesis
-It is usually used to synthesize drugs and biologically active compounds
-It can be used as a ligand in coordination chemistry and metal organic chemistry research
Preparation Method:
1, the preparation of hydrochloride usually involves the following steps:
1. Under appropriate reaction conditions, methylamine and 1,5-dimethyl-1H-pyrazole are reacted through an alkylation reaction to form (1,5-dimethyl-1H-pyrazol-4-yl) methylamine.
2. React (1,5-dimethyl-1H-pyrazol-4-yl) methylamine with hydrochloric acid to obtain 1, hydrochloride.
Safety Information:
- 1, hydrochloride it is relatively safe under normal conditions, it still needs safe operation.
-Wear appropriate protective gloves and glasses when using to prevent contact and inhalation.
-Use under closed ventilation conditions to avoid breathing aerosols or vapors.
-Avoid contact with oxidants and strong acids.
-During storage, it should be kept in a dry, cool, well-ventilated place, away from fire and flammable materials.
Last Update：2024-04-09 02:00:46
